ISSN:
1573-4846
Keywords:
precursor synthesis
;
complexation reactions
;
spectroscopy and analytical chemistry
;
ferroelectric films
Source:
Springer Online Journal Archives 1860-2000
Topics:
Chemistry and Pharmacology
Notes:
Abstract In this investigation, several spectroscopic and analytical techniques were used to determine the chemical compositions and structures of the lead, zirconium, titanium, and Pb-(Zr, Ti) alkoxides involved in the sol-gel synthesis of PZT thin films. These techniques included 1H, 13C, and 207Pb NMR; FT-IR; gas chromatography; Karl Fischer titration; and number-average molecular weights (M n ) determined by cryoscopy. It was found that the titanium precursor had a M n of 548 and a formula of [Ti(OCH2CH2OCH3)4]1.6; the zirconium precursor had a M n of 1015 and a formula of [Zr(OCH2CH2OCH3)4]2.6; and the lead precursor had a formula Pb6(OOCCH3)5(OCH2CH2OCH3)7. 4 H2O and a molecular weight of 2131 (M n =2113). It was observed that residual water from the incomplete dehydration of lead acetate trihydrate coupled with released water due to the esterification of acetic acid caused M-O-M (M=Pb, Zr, Ti) bonds in the Pb-(Zr, Ti) alkoxide. Two possible isomeric structures of the Pb-(Zr, Ti) alkoxide have been proposed. They are both cyclic and have a formula of Pb2M′M″O2(OR)8(ROH)2, (M′M″=Zr and/or Ti) and a molecular weight of 1336 (M n =1386).
Type of Medium:
Electronic Resource
URL:
http://dx.doi.org/10.1007/BF00486168
Permalink
